C27H33F4N5O2 — CID 143879244
(2S)-2-[[(1S)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]-4-fluoro-4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]pentanamide (PubChem CID 143879244) has the molecular formula C27H33F4N5O2 and a molecular weight of 535.59 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]-4-fluoro-4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]pentanamide.
| Compound Name | (2S)-2-[[(1S)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]-4-fluoro-4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]pentanamide |
|---|---|
| PubChem CID | 143879244 |
| Molecular Formula | C27H33F4N5O2 |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (2S)-2-[[(1S)-1-(4-cyanophenyl)-2,2,2-trifluoroethyl]amino]-4-fluoro-4-methyl-N-[2-(4-morpholin-4-ylanilino)ethyl]pentanamide |
| SMILES | CC(C)(F)C[C@H](N[C@@H](c1ccc(C#N)cc1)C(F)(F)F)C(=O)NCCNc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H33F4N5O2/c1-26(2,28)17-23(35-24(27(29,30)31)20-5-3-19(18-32)4-6-20)25(37)34-12-11-33-21-7-9-22(10-8-21)36-13-15-38-16-14-36/h3-10,23-24,33,35H,11-17H2,1-2H3,(H,34,37)/t23-,24-/m0/s1 |
| InChIKey | QTAIAMMPDLUOHL-ZEQRLZLVSA-N |
| XLogP | 4.32 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|