C19H28N2O5 — CID 11068507
4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)benzonitrile (PubChem CID 11068507) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)benzonitrile.
| Compound Name | 4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)benzonitrile |
|---|---|
| PubChem CID | 11068507 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2CCOCCOCCOCCOCCOCC2)cc1 |
| InChI | InChI=1S/C19H28N2O5/c20-17-18-1-3-19(4-2-18)21-5-7-22-9-11-24-13-15-26-16-14-25-12-10-23-8-6-21/h1-4H,5-16H2 |
| InChIKey | HBJMDHJWVXOQMY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 73.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |