C31H43N3O4Si — CID 59747487
4-[[16-[4-(2-trimethylsilylethynyl)phenyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]benzonitrile (PubChem CID 59747487) has the molecular formula C31H43N3O4Si and a molecular weight of 549.79 g/mol. Its IUPAC name is 4-[[16-[4-(2-trimethylsilylethynyl)phenyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]benzonitrile.
| Compound Name | 4-[[16-[4-(2-trimethylsilylethynyl)phenyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 59747487 |
| Molecular Formula | C31H43N3O4Si |
| Molecular Weight | 549.79 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | 4-[[16-[4-(2-trimethylsilylethynyl)phenyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]benzonitrile |
| SMILES | C[Si](C)(C)C#Cc1ccc(N2CCOCCOCCN(Cc3ccc(C#N)cc3)CCOCCOCC2)cc1 |
| InChI | InChI=1S/C31H43N3O4Si/c1-39(2,3)25-12-28-8-10-31(11-9-28)34-15-19-37-23-21-35-17-13-33(14-18-36-22-24-38-20-16-34)27-30-6-4-29(26-32)5-7-30/h4-11H,13-24,27H2,1-3H3 |
| InChIKey | KUWBTJCIISSZRG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|