C22H25N3O2 — CID 34469649
3-(4-cyanophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide (PubChem CID 34469649) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide.
| Compound Name | 3-(4-cyanophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 34469649 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-(4-cyanophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)CCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-24(22(26)11-8-18-2-4-19(16-23)5-3-18)17-20-6-9-21(10-7-20)25-12-14-27-15-13-25/h2-7,9-10H,8,11-15,17H2,1H3 |
| InChIKey | IQYWYAGRGKJDPH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|