C22H26Cl2N2O2 — CID 55826912
4-(3,4-dichlorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide (PubChem CID 55826912) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 55826912 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]butanamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)CCCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H26Cl2N2O2/c1-25(22(27)4-2-3-17-7-10-20(23)21(24)15-17)16-18-5-8-19(9-6-18)26-11-13-28-14-12-26/h5-10,15H,2-4,11-14,16H2,1H3 |
| InChIKey | JLXJNNWEMSMGAY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|