C26H30N2O3 — CID 55713133
N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-4-naphthalen-1-yloxybutanamide (PubChem CID 55713133) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-4-naphthalen-1-yloxybutanamide.
| Compound Name | N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-4-naphthalen-1-yloxybutanamide |
|---|---|
| PubChem CID | 55713133 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-4-naphthalen-1-yloxybutanamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C26H30N2O3/c1-27(20-21-11-13-23(14-12-21)28-15-18-30-19-16-28)26(29)10-5-17-31-25-9-4-7-22-6-2-3-8-24(22)25/h2-4,6-9,11-14H,5,10,15-20H2,1H3 |
| InChIKey | LWIHQRLXDDVXGE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|