C30H33N3O3 — CID 26973103
3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide (PubChem CID 26973103) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide.
| Compound Name | 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 26973103 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]propanamide |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)N(C)Cc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C30H33N3O3/c1-32(21-22-7-11-24(12-8-22)33-17-19-36-20-18-33)29(34)16-15-27-26-5-3-4-6-28(26)31-30(27)23-9-13-25(35-2)14-10-23/h3-14,31H,15-21H2,1-2H3 |
| InChIKey | ZSODDZGGQOWEHU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|