C29H31N3O3 — CID 112798004
3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]propanamide (PubChem CID 112798004) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]propanamide.
| Compound Name | 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 112798004 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)-1H-indol-3-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]propanamide |
| SMILES | COc1ccc(-c2[nH]c3ccccc3c2CCC(=O)Nc2ccc(CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-34-24-12-8-22(9-13-24)29-26(25-4-2-3-5-27(25)31-29)14-15-28(33)30-23-10-6-21(7-11-23)20-32-16-18-35-19-17-32/h2-13,31H,14-20H2,1H3,(H,30,33) |
| InChIKey | WELCTCDMWSRKLJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |