C21H24Cl2N2O — CID 70421787
2-(3,4-dichlorophenyl)-N-methyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide (PubChem CID 70421787) has the molecular formula C21H24Cl2N2O and a molecular weight of 391.34 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-methyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 70421787 |
| Molecular Formula | C21H24Cl2N2O |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[2-(4-pyrrolidin-1-ylphenyl)ethyl]acetamide |
| SMILES | CN(CCc1ccc(N2CCCC2)cc1)C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N2O/c1-24(21(26)15-17-6-9-19(22)20(23)14-17)13-10-16-4-7-18(8-5-16)25-11-2-3-12-25/h4-9,14H,2-3,10-13,15H2,1H3 |
| InChIKey | CLHMIYURNPCLKC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|