C11H14Cl2N2O — CID 115169525
1-[2-(3,4-dichlorophenyl)ethyl]-1,3-dimethylurea (PubChem CID 115169525) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)ethyl]-1,3-dimethylurea.
| Compound Name | 1-[2-(3,4-dichlorophenyl)ethyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 115169525 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)ethyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O/c1-14-11(16)15(2)6-5-8-3-4-9(12)10(13)7-8/h3-4,7H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | OLYJAGPXEGUIBJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |