C14H22N2O2 — CID 115169536
1-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-1,3-dimethylurea (PubChem CID 115169536) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-1,3-dimethylurea.
| Compound Name | 1-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 115169536 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CCc1cc(C)c(OC)c(C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-10-8-12(9-11(2)13(10)18-5)6-7-16(4)14(17)15-3/h8-9H,6-7H2,1-5H3,(H,15,17) |
| InChIKey | OORJROLWVUVYQE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |