C11H17NO2 — CID 82606327
N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine (PubChem CID 82606327) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine.
| Compound Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 82606327 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine |
| SMILES | COc1c(C)cc(CN(C)O)cc1C |
| InChI | InChI=1S/C11H17NO2/c1-8-5-10(7-12(3)13)6-9(2)11(8)14-4/h5-6,13H,7H2,1-4H3 |
| InChIKey | DQEDERNYCFCRHA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|