About N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine
N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine (PubChem CID 82606327) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine.
Molecular Properties
| Compound Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine |
| PubChem CID | 82606327 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine |
| SMILES | COc1c(C)cc(CN(C)O)cc1C |
| InChI | InChI=1S/C11H17NO2/c1-8-5-10(7-12(3)13)6-9(2)11(8)14-4/h5-6,13H,7H2,1-4H3 |
| InChIKey | DQEDERNYCFCRHA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine?
The IUPAC name of N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine (CID 82606327) is N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine.
What is the SMILES notation for N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine?
The canonical SMILES for N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine is COc1c(C)cc(CN(C)O)cc1C.
What is the InChIKey of N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine?
The InChIKey is DQEDERNYCFCRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-8-5-10(7-12(3)13)6-9(2)11(8)14-4/h5-6,13H,7H2,1-4H3.
What are the key properties of N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine?
N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine has a molecular weight of 195.26 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methoxy-3,5-dimethylphenyl)methyl]-N-methylhydroxylamine is sourced from PubChem (CID 82606327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).