C12H19N3O2 — CID 115192837
3-amino-1-[(4-methoxy-3,5-dimethylphenyl)methyl]-1-methylurea (PubChem CID 115192837) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-amino-1-[(4-methoxy-3,5-dimethylphenyl)methyl]-1-methylurea.
| Compound Name | 3-amino-1-[(4-methoxy-3,5-dimethylphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 115192837 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-amino-1-[(4-methoxy-3,5-dimethylphenyl)methyl]-1-methylurea |
| SMILES | COc1c(C)cc(CN(C)C(=O)NN)cc1C |
| InChI | InChI=1S/C12H19N3O2/c1-8-5-10(6-9(2)11(8)17-4)7-15(3)12(16)14-13/h5-6H,7,13H2,1-4H3,(H,14,16) |
| InChIKey | BNQRWLUGMHRUCZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|