C12H19N3O3 — CID 115192794
3-amino-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methylurea (PubChem CID 115192794) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-amino-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methylurea.
| Compound Name | 3-amino-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 115192794 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-amino-1-[(4,5-dimethoxy-2-methylphenyl)methyl]-1-methylurea |
| SMILES | COc1cc(C)c(CN(C)C(=O)NN)cc1OC |
| InChI | InChI=1S/C12H19N3O3/c1-8-5-10(17-3)11(18-4)6-9(8)7-15(2)12(16)14-13/h5-6H,7,13H2,1-4H3,(H,14,16) |
| InChIKey | UMPQYQGRNALYGA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|