C11H17N3O3 — CID 115192661
1-amino-3-[(4,5-dimethoxy-2-methylphenyl)methyl]urea (PubChem CID 115192661) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-amino-3-[(4,5-dimethoxy-2-methylphenyl)methyl]urea.
| Compound Name | 1-amino-3-[(4,5-dimethoxy-2-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 115192661 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-amino-3-[(4,5-dimethoxy-2-methylphenyl)methyl]urea |
| SMILES | COc1cc(C)c(CNC(=O)NN)cc1OC |
| InChI | InChI=1S/C11H17N3O3/c1-7-4-9(16-2)10(17-3)5-8(7)6-13-11(15)14-12/h4-5H,6,12H2,1-3H3,(H2,13,14,15) |
| InChIKey | LIRUIWQDVKHCFK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|