C14H22N2O3 — CID 115169490
1-[2-(2,5-dimethoxy-4-methylphenyl)ethyl]-1,3-dimethylurea (PubChem CID 115169490) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxy-4-methylphenyl)ethyl]-1,3-dimethylurea.
| Compound Name | 1-[2-(2,5-dimethoxy-4-methylphenyl)ethyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 115169490 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[2-(2,5-dimethoxy-4-methylphenyl)ethyl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)CCc1cc(OC)c(C)cc1OC |
| InChI | InChI=1S/C14H22N2O3/c1-10-8-13(19-5)11(9-12(10)18-4)6-7-16(3)14(17)15-2/h8-9H,6-7H2,1-5H3,(H,15,17) |
| InChIKey | AHSBUEUIISQSRD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |