C14H20N2O3 — CID 115192259
N'-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-N'-methyloxamide (PubChem CID 115192259) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N'-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-N'-methyloxamide.
| Compound Name | N'-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 115192259 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N'-[2-(4-methoxy-3,5-dimethylphenyl)ethyl]-N'-methyloxamide |
| SMILES | COc1c(C)cc(CCN(C)C(=O)C(N)=O)cc1C |
| InChI | InChI=1S/C14H20N2O3/c1-9-7-11(8-10(2)12(9)19-4)5-6-16(3)14(18)13(15)17/h7-8H,5-6H2,1-4H3,(H2,15,17) |
| InChIKey | OGKORLGRYHHKCU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|