C16H17ClN2O — CID 110755605
2-(4-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 110755605) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 110755605 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | CN(CCc1ccncc1)C(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClN2O/c1-19(11-8-13-6-9-18-10-7-13)16(20)12-14-2-4-15(17)5-3-14/h2-7,9-10H,8,11-12H2,1H3 |
| InChIKey | ANRIJVUZUMFISV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |