C17H19ClN2O — CID 77080685
3-(2-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)propanamide (PubChem CID 77080685) has the molecular formula C17H19ClN2O and a molecular weight of 302.81 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)propanamide.
| Compound Name | 3-(2-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 77080685 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(2-chlorophenyl)-N-methyl-N-(2-pyridin-4-ylethyl)propanamide |
| SMILES | CN(CCc1ccncc1)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C17H19ClN2O/c1-20(13-10-14-8-11-19-12-9-14)17(21)7-6-15-4-2-3-5-16(15)18/h2-5,8-9,11-12H,6-7,10,13H2,1H3 |
| InChIKey | KTKPAPMJVWTDSU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |