C20H20ClN5O — CID 109257493
2-[(2-chlorophenyl)methylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyrimidine-5-carboxamide (PubChem CID 109257493) has the molecular formula C20H20ClN5O and a molecular weight of 381.87 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109257493 |
| Molecular Formula | C20H20ClN5O |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[(2-chlorophenyl)methylamino]-N-methyl-N-(2-pyridin-4-ylethyl)pyrimidine-5-carboxamide |
| SMILES | CN(CCc1ccncc1)C(=O)c1cnc(NCc2ccccc2Cl)nc1 |
| InChI | InChI=1S/C20H20ClN5O/c1-26(11-8-15-6-9-22-10-7-15)19(27)17-13-24-20(25-14-17)23-12-16-4-2-3-5-18(16)21/h2-7,9-10,13-14H,8,11-12H2,1H3,(H,23,24,25) |
| InChIKey | ZJWMZGPUVSBXFR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |