C18H17ClN2O — CID 31988955
N-[(4-chlorophenyl)methyl]-3-(4-cyanophenyl)-N-methylpropanamide (PubChem CID 31988955) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-(4-cyanophenyl)-N-methylpropanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-(4-cyanophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 31988955 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-(4-cyanophenyl)-N-methylpropanamide |
| SMILES | CN(Cc1ccc(Cl)cc1)C(=O)CCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H17ClN2O/c1-21(13-16-6-9-17(19)10-7-16)18(22)11-8-14-2-4-15(12-20)5-3-14/h2-7,9-10H,8,11,13H2,1H3 |
| InChIKey | GOLTWHRFPORJHD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |