C24H28BNO3 — CID 68756793
4-[[4-[2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethynyl]phenyl]methyl]morpholine (PubChem CID 68756793) has the molecular formula C24H28BNO3 and a molecular weight of 389.30 g/mol. Its IUPAC name is 4-[[4-[2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethynyl]phenyl]methyl]morpholine.
| Compound Name | 4-[[4-[2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethynyl]phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 68756793 |
| Molecular Formula | C24H28BNO3 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 4-[[4-[2-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]ethynyl]phenyl]methyl]morpholine |
| SMILES | CC1(C)COB(c2ccc(C#Cc3ccc(CN4CCOCC4)cc3)cc2)OC1 |
| InChI | InChI=1S/C24H28BNO3/c1-24(2)18-28-25(29-19-24)23-11-9-21(10-12-23)4-3-20-5-7-22(8-6-20)17-26-13-15-27-16-14-26/h5-12H,13-19H2,1-2H3 |
| InChIKey | NGRPECUBYHTXNU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|