C19H31BN2O2 — CID 170863290
1-[3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]propyl]-4-methylpiperazine (PubChem CID 170863290) has the molecular formula C19H31BN2O2 and a molecular weight of 330.28 g/mol. Its IUPAC name is 1-[3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]propyl]-4-methylpiperazine.
| Compound Name | 1-[3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]propyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 170863290 |
| Molecular Formula | C19H31BN2O2 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 1-[3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]propyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCCc2ccc(B3OCC(C)(C)CO3)cc2)CC1 |
| InChI | InChI=1S/C19H31BN2O2/c1-19(2)15-23-20(24-16-19)18-8-6-17(7-9-18)5-4-10-22-13-11-21(3)12-14-22/h6-9H,4-5,10-16H2,1-3H3 |
| InChIKey | VJMUDKSIPKDJLQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|