About 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline
4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline (PubChem CID 170863447) has the molecular formula C20H35N3
and a molecular weight of 317.52 g/mol. Its IUPAC name is 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline.
Molecular Properties
| Compound Name | 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline |
| PubChem CID | 170863447 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline |
| SMILES | CCCN(CCC)c1ccc(CCCN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H35N3/c1-4-12-23(13-5-2)20-10-8-19(9-11-20)7-6-14-22-17-15-21(3)16-18-22/h8-11H,4-7,12-18H2,1-3H3 |
| InChIKey | YHMHRXJNBLACHB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline?
The IUPAC name of 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline (CID 170863447) is 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline.
What is the SMILES notation for 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline?
The canonical SMILES for 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline is CCCN(CCC)c1ccc(CCCN2CCN(C)CC2)cc1.
What is the InChIKey of 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline?
The InChIKey is YHMHRXJNBLACHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N3/c1-4-12-23(13-5-2)20-10-8-19(9-11-20)7-6-14-22-17-15-21(3)16-18-22/h8-11H,4-7,12-18H2,1-3H3.
What are the key properties of 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline?
4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline has a molecular weight of 317.52 g/mol, XLogP of 3.49, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-methylpiperazin-1-yl)propyl]-N,N-dipropylaniline is sourced from PubChem (CID 170863447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).