C36H58N6O2 — CID 165365332
4-[[4-[3-(4-methylpiperazin-1-yl)propyl]-2-nitrophenyl]diazenyl]-N,N-dioctylaniline (PubChem CID 165365332) has the molecular formula C36H58N6O2 and a molecular weight of 606.90 g/mol. Its IUPAC name is 4-[[4-[3-(4-methylpiperazin-1-yl)propyl]-2-nitrophenyl]diazenyl]-N,N-dioctylaniline.
| Compound Name | 4-[[4-[3-(4-methylpiperazin-1-yl)propyl]-2-nitrophenyl]diazenyl]-N,N-dioctylaniline |
|---|---|
| PubChem CID | 165365332 |
| Molecular Formula | C36H58N6O2 |
| Molecular Weight | 606.90 g/mol |
| Exact Mass | 606.46 |
| IUPAC Name | 4-[[4-[3-(4-methylpiperazin-1-yl)propyl]-2-nitrophenyl]diazenyl]-N,N-dioctylaniline |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(/N=N/c2ccc(CCCN3CCN(C)CC3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H58N6O2/c1-4-6-8-10-12-14-25-41(26-15-13-11-9-7-5-2)34-21-19-33(20-22-34)37-38-35-23-18-32(31-36(35)42(43)44)17-16-24-40-29-27-39(3)28-30-40/h18-23,31H,4-17,24-30H2,1-3H3/b38-37+ |
| InChIKey | OUOXNEJBBSGQAX-HEFFKOSUSA-N |
| XLogP | 9.72 |
| TPSA | 77.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.90 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|