C29H38N6O4 — CID 145172306
2-[N-butyl-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanol;ethane (PubChem CID 145172306) has the molecular formula C29H38N6O4 and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[N-butyl-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanol;ethane.
| Compound Name | 2-[N-butyl-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanol;ethane |
|---|---|
| PubChem CID | 145172306 |
| Molecular Formula | C29H38N6O4 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 2-[N-butyl-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanol;ethane |
| SMILES | CC.CCCCN(CCO)c1ccc(/N=N/c2cc(C)c(/N=N/c3ccc(C)cc3[N+](=O)[O-])cc2OC)cc1 |
| InChI | InChI=1S/C27H32N6O4.C2H6/c1-5-6-13-32(14-15-34)22-10-8-21(9-11-22)28-31-25-17-20(3)24(18-27(25)37-4)30-29-23-12-7-19(2)16-26(23)33(35)36;1-2/h7-12,16-18,34H,5-6,13-15H2,1-4H3;1-2H3/b30-29+,31-28+; |
| InChIKey | XVWCCKIXXQCGEN-GSRGAECLSA-N |
| XLogP | 8.68 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|