C25H27N6O5- — CID 176862758
2-[N-(2-hydroxyethyl)-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanolate (PubChem CID 176862758) has the molecular formula C25H27N6O5- and a molecular weight of 491.53 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanolate.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanolate |
|---|---|
| PubChem CID | 176862758 |
| Molecular Formula | C25H27N6O5- |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-[[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]diazenyl]anilino]ethanolate |
| SMILES | COc1cc(/N=N/c2ccc(C)cc2[N+](=O)[O-])c(C)cc1/N=N/c1ccc(N(CC[O-])CCO)cc1 |
| InChI | InChI=1S/C25H27N6O5/c1-17-4-9-21(24(14-17)31(34)35)27-28-22-16-25(36-3)23(15-18(22)2)29-26-19-5-7-20(8-6-19)30(10-12-32)11-13-33/h4-9,14-16,32H,10-13H2,1-3H3/q-1/b28-27+,29-26+ |
| InChIKey | XGODGGBSRDSYFK-KPXCSAHWSA-N |
| XLogP | 5.21 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|