C24H25IN5O3- — CID 163798769
[2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]-(4-propan-2-yliodanuidylphenyl)diazene (PubChem CID 163798769) has the molecular formula C24H25IN5O3- and a molecular weight of 558.40 g/mol. Its IUPAC name is [2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]-(4-propan-2-yliodanuidylphenyl)diazene.
| Compound Name | [2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]-(4-propan-2-yliodanuidylphenyl)diazene |
|---|---|
| PubChem CID | 163798769 |
| Molecular Formula | C24H25IN5O3- |
| Molecular Weight | 558.40 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | [2-methoxy-5-methyl-4-[(4-methyl-2-nitrophenyl)diazenyl]phenyl]-(4-propan-2-yliodanuidylphenyl)diazene |
| SMILES | COc1cc(/N=N/c2ccc(C)cc2[N+](=O)[O-])c(C)cc1/N=N/c1ccc([I-]C(C)C)cc1 |
| InChI | InChI=1S/C24H25IN5O3/c1-15(2)25-18-7-9-19(10-8-18)26-29-22-13-17(4)21(14-24(22)33-5)28-27-20-11-6-16(3)12-23(20)30(31)32/h6-15H,1-5H3/q-1/b28-27+,29-26+ |
| InChIKey | LWVIIKDICVSPDW-KPXCSAHWSA-N |
| XLogP | 4.72 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|