C18H22N2O2 — CID 59237990
(2,5-dimethoxy-4-propan-2-ylphenyl)-(4-methylphenyl)diazene (PubChem CID 59237990) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2,5-dimethoxy-4-propan-2-ylphenyl)-(4-methylphenyl)diazene.
| Compound Name | (2,5-dimethoxy-4-propan-2-ylphenyl)-(4-methylphenyl)diazene |
|---|---|
| PubChem CID | 59237990 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2,5-dimethoxy-4-propan-2-ylphenyl)-(4-methylphenyl)diazene |
| SMILES | COc1cc(C(C)C)c(OC)cc1/N=N/c1ccc(C)cc1 |
| InChI | InChI=1S/C18H22N2O2/c1-12(2)15-10-18(22-5)16(11-17(15)21-4)20-19-14-8-6-13(3)7-9-14/h6-12H,1-5H3/b20-19+ |
| InChIKey | KBMVVHDHCPGCON-FMQUCBEESA-N |
| XLogP | 5.55 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|