C20H23NO4S — CID 87616052
1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,4-dimethoxy-5-propan-2-ylbenzene (PubChem CID 87616052) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,4-dimethoxy-5-propan-2-ylbenzene.
| Compound Name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,4-dimethoxy-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 87616052 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[isocyano-(4-methylphenyl)sulfonylmethyl]-2,4-dimethoxy-5-propan-2-ylbenzene |
| SMILES | [C-]#[N+]C(c1cc(C(C)C)c(OC)cc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-13(2)16-11-17(19(25-6)12-18(16)24-5)20(21-4)26(22,23)15-9-7-14(3)8-10-15/h7-13,20H,1-3,5-6H3 |
| InChIKey | YMWNTYRZPGVQOX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|