C15H11Cl2NO2S — CID 46738240
1,2-dichloro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene (PubChem CID 46738240) has the molecular formula C15H11Cl2NO2S and a molecular weight of 340.23 g/mol. Its IUPAC name is 1,2-dichloro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene.
| Compound Name | 1,2-dichloro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
|---|---|
| PubChem CID | 46738240 |
| Molecular Formula | C15H11Cl2NO2S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 1,2-dichloro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
| SMILES | [C-]#[N+]C(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H11Cl2NO2S/c1-10-3-6-12(7-4-10)21(19,20)15(18-2)11-5-8-13(16)14(17)9-11/h3-9,15H,1H3 |
| InChIKey | KNIKDPRISVIPBU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|