C23H29NO2S — CID 131742786
1,3-ditert-butyl-5-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene (PubChem CID 131742786) has the molecular formula C23H29NO2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene.
| Compound Name | 1,3-ditert-butyl-5-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
|---|---|
| PubChem CID | 131742786 |
| Molecular Formula | C23H29NO2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 1,3-ditert-butyl-5-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
| SMILES | [C-]#[N+]C(c1cc(C(C)(C)C)cc(C(C)(C)C)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29NO2S/c1-16-9-11-20(12-10-16)27(25,26)21(24-8)17-13-18(22(2,3)4)15-19(14-17)23(5,6)7/h9-15,21H,1-7H3 |
| InChIKey | YPWKISQMYZJBFI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|