C18H19NO4S — CID 71773573
4-[2-isocyano-2-(4-methylphenyl)sulfonylethyl]-1,2-dimethoxybenzene (PubChem CID 71773573) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[2-isocyano-2-(4-methylphenyl)sulfonylethyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[2-isocyano-2-(4-methylphenyl)sulfonylethyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 71773573 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-[2-isocyano-2-(4-methylphenyl)sulfonylethyl]-1,2-dimethoxybenzene |
| SMILES | [C-]#[N+]C(Cc1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-13-5-8-15(9-6-13)24(20,21)18(19-2)12-14-7-10-16(22-3)17(11-14)23-4/h5-11,18H,12H2,1,3-4H3 |
| InChIKey | NUFUGGDTEBWABI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|