C25H28O8S2 — CID 11203190
[(2S)-2-(hydroxymethyl)-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] 4-methylbenzenesulfonate (PubChem CID 11203190) has the molecular formula C25H28O8S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is [(2S)-2-(hydroxymethyl)-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-(hydroxymethyl)-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11203190 |
| Molecular Formula | C25H28O8S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | [(2S)-2-(hydroxymethyl)-3-[3-methoxy-4-(4-methylphenyl)sulfonyloxyphenyl]propyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(C[C@@H](CO)COS(=O)(=O)c2ccc(C)cc2)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H28O8S2/c1-18-4-9-22(10-5-18)34(27,28)32-17-21(16-26)14-20-8-13-24(25(15-20)31-3)33-35(29,30)23-11-6-19(2)7-12-23/h4-13,15,21,26H,14,16-17H2,1-3H3/t21-/m0/s1 |
| InChIKey | SVRLCPMJUWFEPT-NRFANRHFSA-N |
| XLogP | 3.64 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|