C17H20O5S2 — CID 45112649
[2,6-dimethoxy-4-(2-sulfanylethyl)phenyl] 4-methylbenzenesulfonate (PubChem CID 45112649) has the molecular formula C17H20O5S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is [2,6-dimethoxy-4-(2-sulfanylethyl)phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2,6-dimethoxy-4-(2-sulfanylethyl)phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 45112649 |
| Molecular Formula | C17H20O5S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [2,6-dimethoxy-4-(2-sulfanylethyl)phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(CCS)cc(OC)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20O5S2/c1-12-4-6-14(7-5-12)24(18,19)22-17-15(20-2)10-13(8-9-23)11-16(17)21-3/h4-7,10-11,23H,8-9H2,1-3H3 |
| InChIKey | QVIKLXGIJTUVGB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|