C21H20ClNO4S — CID 126116668
[4-(anilinomethyl)-2-chloro-6-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 126116668) has the molecular formula C21H20ClNO4S and a molecular weight of 417.91 g/mol. Its IUPAC name is [4-(anilinomethyl)-2-chloro-6-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(anilinomethyl)-2-chloro-6-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126116668 |
| Molecular Formula | C21H20ClNO4S |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [4-(anilinomethyl)-2-chloro-6-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(CNc2ccccc2)cc(Cl)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H20ClNO4S/c1-15-8-10-18(11-9-15)28(24,25)27-21-19(22)12-16(13-20(21)26-2)14-23-17-6-4-3-5-7-17/h3-13,23H,14H2,1-2H3 |
| InChIKey | UVFLXXIBYJNWNA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|