C24H28Cl2N2O4S — CID 17055605
4-[2-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 17055605) has the molecular formula C24H28Cl2N2O4S and a molecular weight of 511.47 g/mol. Its IUPAC name is 4-[2-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[2-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 17055605 |
| Molecular Formula | C24H28Cl2N2O4S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 4-[2-[[3-chloro-5-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | COc1cc(CNCCc2ccc(S(N)(=O)=O)cc2)cc(Cl)c1OCc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C24H27ClN2O4S.ClH/c1-17-3-5-19(6-4-17)16-31-24-22(25)13-20(14-23(24)30-2)15-27-12-11-18-7-9-21(10-8-18)32(26,28)29;/h3-10,13-14,27H,11-12,15-16H2,1-2H3,(H2,26,28,29);1H |
| InChIKey | ULYLNUMRNZOPQE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|