C19H12F5NO3S — CID 101477255
(2,3,4,5,6-pentafluorophenyl) 4-(anilinomethyl)benzenesulfonate (PubChem CID 101477255) has the molecular formula C19H12F5NO3S and a molecular weight of 429.37 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(anilinomethyl)benzenesulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(anilinomethyl)benzenesulfonate |
|---|---|
| PubChem CID | 101477255 |
| Molecular Formula | C19H12F5NO3S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(anilinomethyl)benzenesulfonate |
| SMILES | O=S(=O)(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(CNc2ccccc2)cc1 |
| InChI | InChI=1S/C19H12F5NO3S/c20-14-15(21)17(23)19(18(24)16(14)22)28-29(26,27)13-8-6-11(7-9-13)10-25-12-4-2-1-3-5-12/h1-9,25H,10H2 |
| InChIKey | IXEYBZNQEASDBI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|