About 4-(anilinomethyl)aniline;dihydrochloride
4-(anilinomethyl)aniline;dihydrochloride (PubChem CID 517605) has the molecular formula C13H16Cl2N2
and a molecular weight of 271.19 g/mol. Its IUPAC name is 4-(anilinomethyl)aniline;dihydrochloride.
Molecular Properties
| Compound Name | 4-(anilinomethyl)aniline;dihydrochloride |
| PubChem CID | 517605 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(anilinomethyl)aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CNc2ccccc2)cc1 |
| InChI | InChI=1S/C13H14N2.2ClH/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13;;/h1-9,15H,10,14H2;2*1H |
| InChIKey | XZMJMZMJNVEEQY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(anilinomethyl)aniline;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(anilinomethyl)aniline;dihydrochloride?
The IUPAC name of 4-(anilinomethyl)aniline;dihydrochloride (CID 517605) is 4-(anilinomethyl)aniline;dihydrochloride.
What is the SMILES notation for 4-(anilinomethyl)aniline;dihydrochloride?
The canonical SMILES for 4-(anilinomethyl)aniline;dihydrochloride is Cl.Cl.Nc1ccc(CNc2ccccc2)cc1.
What is the InChIKey of 4-(anilinomethyl)aniline;dihydrochloride?
The InChIKey is XZMJMZMJNVEEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.2ClH/c14-12-8-6-11(7-9-12)10-15-13-4-2-1-3-5-13;;/h1-9,15H,10,14H2;2*1H.
What are the key properties of 4-(anilinomethyl)aniline;dihydrochloride?
4-(anilinomethyl)aniline;dihydrochloride has a molecular weight of 271.19 g/mol, XLogP of 3.72, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(anilinomethyl)aniline;dihydrochloride is sourced from PubChem (CID 517605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).