C11H13ClN2O — CID 22486431
4-N-(furan-3-ylmethyl)benzene-1,4-diamine;hydrochloride (PubChem CID 22486431) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 4-N-(furan-3-ylmethyl)benzene-1,4-diamine;hydrochloride.
| Compound Name | 4-N-(furan-3-ylmethyl)benzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 22486431 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 4-N-(furan-3-ylmethyl)benzene-1,4-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(NCc2ccoc2)cc1 |
| InChI | InChI=1S/C11H12N2O.ClH/c12-10-1-3-11(4-2-10)13-7-9-5-6-14-8-9;/h1-6,8,13H,7,12H2;1H |
| InChIKey | GPHMLLOPRPQWHI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|