C13H17ClN4 — CID 23437151
5-[(4-aminoanilino)methyl]benzene-1,3-diamine;hydrochloride (PubChem CID 23437151) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is 5-[(4-aminoanilino)methyl]benzene-1,3-diamine;hydrochloride.
| Compound Name | 5-[(4-aminoanilino)methyl]benzene-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 23437151 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-[(4-aminoanilino)methyl]benzene-1,3-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(NCc2cc(N)cc(N)c2)cc1 |
| InChI | InChI=1S/C13H16N4.ClH/c14-10-1-3-13(4-2-10)17-8-9-5-11(15)7-12(16)6-9;/h1-7,17H,8,14-16H2;1H |
| InChIKey | UWIASMTXKMLBML-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|