C21H28N2 — CID 59230054
4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]aniline (PubChem CID 59230054) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]aniline.
| Compound Name | 4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]aniline |
|---|---|
| PubChem CID | 59230054 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 4-[[4-(3,5-dimethylcyclohexyl)anilino]methyl]aniline |
| SMILES | CC1CC(C)CC(c2ccc(NCc3ccc(N)cc3)cc2)C1 |
| InChI | InChI=1S/C21H28N2/c1-15-11-16(2)13-19(12-15)18-5-9-21(10-6-18)23-14-17-3-7-20(22)8-4-17/h3-10,15-16,19,23H,11-14,22H2,1-2H3 |
| InChIKey | YWHOCYVZFCLFCE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|