C13H16ClN3 — CID 70546095
3-N-[(3-aminophenyl)methyl]benzene-1,3-diamine;hydrochloride (PubChem CID 70546095) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is 3-N-[(3-aminophenyl)methyl]benzene-1,3-diamine;hydrochloride.
| Compound Name | 3-N-[(3-aminophenyl)methyl]benzene-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 70546095 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-N-[(3-aminophenyl)methyl]benzene-1,3-diamine;hydrochloride |
| SMILES | Cl.Nc1cccc(CNc2cccc(N)c2)c1 |
| InChI | InChI=1S/C13H15N3.ClH/c14-11-4-1-3-10(7-11)9-16-13-6-2-5-12(15)8-13;/h1-8,16H,9,14-15H2;1H |
| InChIKey | WTLWNMWCOHQAEN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|