C15H20N4 — CID 12040476
3-N-[3-(3-aminoanilino)propyl]benzene-1,3-diamine (PubChem CID 12040476) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-N-[3-(3-aminoanilino)propyl]benzene-1,3-diamine.
| Compound Name | 3-N-[3-(3-aminoanilino)propyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 12040476 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-N-[3-(3-aminoanilino)propyl]benzene-1,3-diamine |
| SMILES | Nc1cccc(NCCCNc2cccc(N)c2)c1 |
| InChI | InChI=1S/C15H20N4/c16-12-4-1-6-14(10-12)18-8-3-9-19-15-7-2-5-13(17)11-15/h1-2,4-7,10-11,18-19H,3,8-9,16-17H2 |
| InChIKey | NIMBMRRCWCXWTE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|