C15H19ClN2 — CID 68721632
N,N'-diphenylpropane-1,3-diamine;hydrochloride (PubChem CID 68721632) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is N,N'-diphenylpropane-1,3-diamine;hydrochloride.
| Compound Name | N,N'-diphenylpropane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 68721632 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N,N'-diphenylpropane-1,3-diamine;hydrochloride |
| SMILES | Cl.c1ccc(NCCCNc2ccccc2)cc1 |
| InChI | InChI=1S/C15H18N2.ClH/c1-3-8-14(9-4-1)16-12-7-13-17-15-10-5-2-6-11-15;/h1-6,8-11,16-17H,7,12-13H2;1H |
| InChIKey | GFRLDEIGQQZLBX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|