C14H18N2Na2 — CID 173210842
disodium;N,N'-diphenylethane-1,2-diamine;hydride (PubChem CID 173210842) has the molecular formula C14H18N2Na2 and a molecular weight of 260.29 g/mol. Its IUPAC name is disodium;N,N'-diphenylethane-1,2-diamine;hydride.
| Compound Name | disodium;N,N'-diphenylethane-1,2-diamine;hydride |
|---|---|
| PubChem CID | 173210842 |
| Molecular Formula | C14H18N2Na2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | disodium;N,N'-diphenylethane-1,2-diamine;hydride |
| SMILES | [H-].[H-].[Na+].[Na+].c1ccc(NCCNc2ccccc2)cc1 |
| InChI | InChI=1S/C14H16N2.2Na.2H/c1-3-7-13(8-4-1)15-11-12-16-14-9-5-2-6-10-14;;;;/h1-10,15-16H,11-12H2;;;;/q;2*+1;2*-1 |
| InChIKey | QRBVUJHFGLOQDZ-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|