C11H16Cl2N2 — CID 70560636
N-(2,2-dichloroethyl)-N'-phenylpropane-1,3-diamine (PubChem CID 70560636) has the molecular formula C11H16Cl2N2 and a molecular weight of 247.17 g/mol. Its IUPAC name is N-(2,2-dichloroethyl)-N'-phenylpropane-1,3-diamine.
| Compound Name | N-(2,2-dichloroethyl)-N'-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 70560636 |
| Molecular Formula | C11H16Cl2N2 |
| Molecular Weight | 247.17 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2,2-dichloroethyl)-N'-phenylpropane-1,3-diamine |
| SMILES | ClC(Cl)CNCCCNc1ccccc1 |
| InChI | InChI=1S/C11H16Cl2N2/c12-11(13)9-14-7-4-8-15-10-5-2-1-3-6-10/h1-3,5-6,11,14-15H,4,7-9H2 |
| InChIKey | WWFJKQNRSYCPON-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|