About N-(4-butyloctyl)aniline
N-(4-butyloctyl)aniline (PubChem CID 175196464) has the molecular formula C18H31N
and a molecular weight of 261.45 g/mol. Its IUPAC name is N-(4-butyloctyl)aniline.
Molecular Properties
| Compound Name | N-(4-butyloctyl)aniline |
| PubChem CID | 175196464 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | N-(4-butyloctyl)aniline |
| SMILES | CCCCC(CCCC)CCCNc1ccccc1 |
| InChI | InChI=1S/C18H31N/c1-3-5-11-17(12-6-4-2)13-10-16-19-18-14-8-7-9-15-18/h7-9,14-15,17,19H,3-6,10-13,16H2,1-2H3 |
| InChIKey | STSRBWVKNYWRTQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4-butyloctyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-butyloctyl)aniline?
The IUPAC name of N-(4-butyloctyl)aniline (CID 175196464) is N-(4-butyloctyl)aniline.
What is the SMILES notation for N-(4-butyloctyl)aniline?
The canonical SMILES for N-(4-butyloctyl)aniline is CCCCC(CCCC)CCCNc1ccccc1.
What is the InChIKey of N-(4-butyloctyl)aniline?
The InChIKey is STSRBWVKNYWRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H31N/c1-3-5-11-17(12-6-4-2)13-10-16-19-18-14-8-7-9-15-18/h7-9,14-15,17,19H,3-6,10-13,16H2,1-2H3.
What are the key properties of N-(4-butyloctyl)aniline?
N-(4-butyloctyl)aniline has a molecular weight of 261.45 g/mol, XLogP of 5.88, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-butyloctyl)aniline is sourced from PubChem (CID 175196464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).