About 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid
2-anilinoethanol;(2S)-2-hydroxyhexanoic acid (PubChem CID 90456183) has the molecular formula C14H23NO4
and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid.
Molecular Properties
| Compound Name | 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid |
| PubChem CID | 90456183 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid |
| SMILES | CCCC[C@H](O)C(=O)O.OCCNc1ccccc1 |
| InChI | InChI=1S/C8H11NO.C6H12O3/c10-7-6-9-8-4-2-1-3-5-8;1-2-3-4-5(7)6(8)9/h1-5,9-10H,6-7H2;5,7H,2-4H2,1H3,(H,8,9)/t;5-/m.0/s1 |
| InChIKey | HBXYGBGYNBBDGR-ZSCHJXSPSA-N |
| XLogP | 1.71 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid?
The IUPAC name of 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid (CID 90456183) is 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid.
What is the SMILES notation for 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid?
The canonical SMILES for 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid is CCCC[C@H](O)C(=O)O.OCCNc1ccccc1.
What is the InChIKey of 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid?
The InChIKey is HBXYGBGYNBBDGR-ZSCHJXSPSA-N. The full InChI is InChI=1S/C8H11NO.C6H12O3/c10-7-6-9-8-4-2-1-3-5-8;1-2-3-4-5(7)6(8)9/h1-5,9-10H,6-7H2;5,7H,2-4H2,1H3,(H,8,9)/t;5-/m.0/s1.
What are the key properties of 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid?
2-anilinoethanol;(2S)-2-hydroxyhexanoic acid has a molecular weight of 269.34 g/mol, XLogP of 1.71, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilinoethanol;(2S)-2-hydroxyhexanoic acid is sourced from PubChem (CID 90456183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).