About 1-anilinooctan-4-one
1-anilinooctan-4-one (PubChem CID 10680405) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-anilinooctan-4-one.
Molecular Properties
| Compound Name | 1-anilinooctan-4-one |
| PubChem CID | 10680405 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-anilinooctan-4-one |
| SMILES | CCCCC(=O)CCCNc1ccccc1 |
| InChI | InChI=1S/C14H21NO/c1-2-3-10-14(16)11-7-12-15-13-8-5-4-6-9-13/h4-6,8-9,15H,2-3,7,10-12H2,1H3 |
| InChIKey | UXZIKTDRAAQVJS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-anilinooctan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilinooctan-4-one?
The IUPAC name of 1-anilinooctan-4-one (CID 10680405) is 1-anilinooctan-4-one.
What is the SMILES notation for 1-anilinooctan-4-one?
The canonical SMILES for 1-anilinooctan-4-one is CCCCC(=O)CCCNc1ccccc1.
What is the InChIKey of 1-anilinooctan-4-one?
The InChIKey is UXZIKTDRAAQVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-2-3-10-14(16)11-7-12-15-13-8-5-4-6-9-13/h4-6,8-9,15H,2-3,7,10-12H2,1H3.
What are the key properties of 1-anilinooctan-4-one?
1-anilinooctan-4-one has a molecular weight of 219.33 g/mol, XLogP of 3.64, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilinooctan-4-one is sourced from PubChem (CID 10680405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).